C12H13NO4 — CID 145174789
(E)-3-(6-methoxy-4-methyl-1,3-benzodioxol-5-yl)prop-2-enamide (PubChem CID 145174789) has the molecular formula C12H13NO4 and a molecular weight of 235.24 g/mol. Its IUPAC name is (E)-3-(6-methoxy-4-methyl-1,3-benzodioxol-5-yl)prop-2-enamide.
| Compound Name | (E)-3-(6-methoxy-4-methyl-1,3-benzodioxol-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 145174789 |
| Molecular Formula | C12H13NO4 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | (E)-3-(6-methoxy-4-methyl-1,3-benzodioxol-5-yl)prop-2-enamide |
| SMILES | COc1cc2c(c(C)c1/C=C/C(N)=O)OCO2 |
| InChI | InChI=1S/C12H13NO4/c1-7-8(3-4-11(13)14)9(15-2)5-10-12(7)17-6-16-10/h3-5H,6H2,1-2H3,(H2,13,14)/b4-3+ |
| InChIKey | PRUWULUPFCAVHA-ONEGZZNKSA-N |
| XLogP | 1.23 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|