C15H14N2O6S2 — CID 122633294
(E)-3-[4-methoxy-6-(thiophen-2-ylsulfonylamino)-1,3-benzodioxol-5-yl]prop-2-enamide (PubChem CID 122633294) has the molecular formula C15H14N2O6S2 and a molecular weight of 382.42 g/mol. Its IUPAC name is (E)-3-[4-methoxy-6-(thiophen-2-ylsulfonylamino)-1,3-benzodioxol-5-yl]prop-2-enamide.
| Compound Name | (E)-3-[4-methoxy-6-(thiophen-2-ylsulfonylamino)-1,3-benzodioxol-5-yl]prop-2-enamide |
|---|---|
| PubChem CID | 122633294 |
| Molecular Formula | C15H14N2O6S2 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.03 |
| IUPAC Name | (E)-3-[4-methoxy-6-(thiophen-2-ylsulfonylamino)-1,3-benzodioxol-5-yl]prop-2-enamide |
| SMILES | COc1c(/C=C/C(N)=O)c(NS(=O)(=O)c2cccs2)cc2c1OCO2 |
| InChI | InChI=1S/C15H14N2O6S2/c1-21-14-9(4-5-12(16)18)10(7-11-15(14)23-8-22-11)17-25(19,20)13-3-2-6-24-13/h2-7,17H,8H2,1H3,(H2,16,18)/b5-4+ |
| InChIKey | CUEGOTRFVYVBTG-SNAWJCMRSA-N |
| XLogP | 1.78 |
| TPSA | 116.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|