C17H17NO6S2 — CID 118477180
ethyl (E)-3-[4-methyl-7-(thiophen-2-ylsulfonylamino)-1,3-benzodioxol-5-yl]prop-2-enoate (PubChem CID 118477180) has the molecular formula C17H17NO6S2 and a molecular weight of 395.46 g/mol. Its IUPAC name is ethyl (E)-3-[4-methyl-7-(thiophen-2-ylsulfonylamino)-1,3-benzodioxol-5-yl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[4-methyl-7-(thiophen-2-ylsulfonylamino)-1,3-benzodioxol-5-yl]prop-2-enoate |
|---|---|
| PubChem CID | 118477180 |
| Molecular Formula | C17H17NO6S2 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.05 |
| IUPAC Name | ethyl (E)-3-[4-methyl-7-(thiophen-2-ylsulfonylamino)-1,3-benzodioxol-5-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1cc(NS(=O)(=O)c2cccs2)c2c(c1C)OCO2 |
| InChI | InChI=1S/C17H17NO6S2/c1-3-22-14(19)7-6-12-9-13(17-16(11(12)2)23-10-24-17)18-26(20,21)15-5-4-8-25-15/h4-9,18H,3,10H2,1-2H3/b7-6+ |
| InChIKey | GKCXYFFZQSNAFV-VOTSOKGWSA-N |
| XLogP | 3.16 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|