C18H17NO7S2 — CID 123281197
cyclopropyl 3-[4-methoxy-7-(thiophen-2-ylsulfonylamino)-1,3-benzodioxol-5-yl]prop-2-enoate (PubChem CID 123281197) has the molecular formula C18H17NO7S2 and a molecular weight of 423.47 g/mol. Its IUPAC name is cyclopropyl 3-[4-methoxy-7-(thiophen-2-ylsulfonylamino)-1,3-benzodioxol-5-yl]prop-2-enoate.
| Compound Name | cyclopropyl 3-[4-methoxy-7-(thiophen-2-ylsulfonylamino)-1,3-benzodioxol-5-yl]prop-2-enoate |
|---|---|
| PubChem CID | 123281197 |
| Molecular Formula | C18H17NO7S2 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.04 |
| IUPAC Name | cyclopropyl 3-[4-methoxy-7-(thiophen-2-ylsulfonylamino)-1,3-benzodioxol-5-yl]prop-2-enoate |
| SMILES | COc1c(C=CC(=O)OC2CC2)cc(NS(=O)(=O)c2cccs2)c2c1OCO2 |
| InChI | InChI=1S/C18H17NO7S2/c1-23-16-11(4-7-14(20)26-12-5-6-12)9-13(17-18(16)25-10-24-17)19-28(21,22)15-3-2-8-27-15/h2-4,7-9,12,19H,5-6,10H2,1H3 |
| InChIKey | MUCFXIAISAEXSG-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|