C17H19NO7S2 — CID 134256439
N-[6-[(E)-3-ethoxy-3-hydroxyprop-1-enyl]-7-methoxy-1,3-benzodioxol-4-yl]thiophene-2-sulfonamide (PubChem CID 134256439) has the molecular formula C17H19NO7S2 and a molecular weight of 413.47 g/mol. Its IUPAC name is N-[6-[(E)-3-ethoxy-3-hydroxyprop-1-enyl]-7-methoxy-1,3-benzodioxol-4-yl]thiophene-2-sulfonamide.
| Compound Name | N-[6-[(E)-3-ethoxy-3-hydroxyprop-1-enyl]-7-methoxy-1,3-benzodioxol-4-yl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 134256439 |
| Molecular Formula | C17H19NO7S2 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.06 |
| IUPAC Name | N-[6-[(E)-3-ethoxy-3-hydroxyprop-1-enyl]-7-methoxy-1,3-benzodioxol-4-yl]thiophene-2-sulfonamide |
| SMILES | CCOC(O)/C=C/c1cc(NS(=O)(=O)c2cccs2)c2c(c1OC)OCO2 |
| InChI | InChI=1S/C17H19NO7S2/c1-3-23-13(19)7-6-11-9-12(16-17(15(11)22-2)25-10-24-16)18-27(20,21)14-5-4-8-26-14/h4-9,13,18-19H,3,10H2,1-2H3/b7-6+ |
| InChIKey | AHFCLLBMMKINMW-VOTSOKGWSA-N |
| XLogP | 2.65 |
| TPSA | 103.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|