C14H15NO7S2 — CID 17426161
3,4,5-trimethoxy-2-(thiophen-2-ylsulfonylamino)benzoic acid (PubChem CID 17426161) has the molecular formula C14H15NO7S2 and a molecular weight of 373.41 g/mol. Its IUPAC name is 3,4,5-trimethoxy-2-(thiophen-2-ylsulfonylamino)benzoic acid.
| Compound Name | 3,4,5-trimethoxy-2-(thiophen-2-ylsulfonylamino)benzoic acid |
|---|---|
| PubChem CID | 17426161 |
| Molecular Formula | C14H15NO7S2 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.03 |
| IUPAC Name | 3,4,5-trimethoxy-2-(thiophen-2-ylsulfonylamino)benzoic acid |
| SMILES | COc1cc(C(=O)O)c(NS(=O)(=O)c2cccs2)c(OC)c1OC |
| InChI | InChI=1S/C14H15NO7S2/c1-20-9-7-8(14(16)17)11(13(22-3)12(9)21-2)15-24(18,19)10-5-4-6-23-10/h4-7,15H,1-3H3,(H,16,17) |
| InChIKey | DNJUKHZLOKBIDP-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |