C22H24N2O6S2 — CID 92502327
(2S)-3-phenyl-2-(thiophen-2-ylsulfonylamino)-N-(3,4,5-trimethoxyphenyl)propanamide (PubChem CID 92502327) has the molecular formula C22H24N2O6S2 and a molecular weight of 476.58 g/mol. Its IUPAC name is (2S)-3-phenyl-2-(thiophen-2-ylsulfonylamino)-N-(3,4,5-trimethoxyphenyl)propanamide.
| Compound Name | (2S)-3-phenyl-2-(thiophen-2-ylsulfonylamino)-N-(3,4,5-trimethoxyphenyl)propanamide |
|---|---|
| PubChem CID | 92502327 |
| Molecular Formula | C22H24N2O6S2 |
| Molecular Weight | 476.58 g/mol |
| Exact Mass | 476.11 |
| IUPAC Name | (2S)-3-phenyl-2-(thiophen-2-ylsulfonylamino)-N-(3,4,5-trimethoxyphenyl)propanamide |
| SMILES | COc1cc(NC(=O)[C@H](Cc2ccccc2)NS(=O)(=O)c2cccs2)cc(OC)c1OC |
| InChI | InChI=1S/C22H24N2O6S2/c1-28-18-13-16(14-19(29-2)21(18)30-3)23-22(25)17(12-15-8-5-4-6-9-15)24-32(26,27)20-10-7-11-31-20/h4-11,13-14,17,24H,12H2,1-3H3,(H,23,25)/t17-/m0/s1 |
| InChIKey | UNIBAMNYMWTYHV-KRWDZBQOSA-N |
| XLogP | 3.30 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.58 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |