C21H22N2O3S2 — CID 92726709
(2S)-N-(3,5-dimethylphenyl)-3-phenyl-2-(thiophen-2-ylsulfonylamino)propanamide (PubChem CID 92726709) has the molecular formula C21H22N2O3S2 and a molecular weight of 414.55 g/mol. Its IUPAC name is (2S)-N-(3,5-dimethylphenyl)-3-phenyl-2-(thiophen-2-ylsulfonylamino)propanamide.
| Compound Name | (2S)-N-(3,5-dimethylphenyl)-3-phenyl-2-(thiophen-2-ylsulfonylamino)propanamide |
|---|---|
| PubChem CID | 92726709 |
| Molecular Formula | C21H22N2O3S2 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | (2S)-N-(3,5-dimethylphenyl)-3-phenyl-2-(thiophen-2-ylsulfonylamino)propanamide |
| SMILES | Cc1cc(C)cc(NC(=O)[C@H](Cc2ccccc2)NS(=O)(=O)c2cccs2)c1 |
| InChI | InChI=1S/C21H22N2O3S2/c1-15-11-16(2)13-18(12-15)22-21(24)19(14-17-7-4-3-5-8-17)23-28(25,26)20-9-6-10-27-20/h3-13,19,23H,14H2,1-2H3,(H,22,24)/t19-/m0/s1 |
| InChIKey | XPXSHADPBITRLX-IBGZPJMESA-N |
| XLogP | 3.89 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |