C14H16N2O6S2 — CID 8523641
3,4,5-trimethoxy-N'-thiophen-2-ylsulfonylbenzohydrazide (PubChem CID 8523641) has the molecular formula C14H16N2O6S2 and a molecular weight of 372.42 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N'-thiophen-2-ylsulfonylbenzohydrazide.
| Compound Name | 3,4,5-trimethoxy-N'-thiophen-2-ylsulfonylbenzohydrazide |
|---|---|
| PubChem CID | 8523641 |
| Molecular Formula | C14H16N2O6S2 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.04 |
| IUPAC Name | 3,4,5-trimethoxy-N'-thiophen-2-ylsulfonylbenzohydrazide |
| SMILES | COc1cc(C(=O)NNS(=O)(=O)c2cccs2)cc(OC)c1OC |
| InChI | InChI=1S/C14H16N2O6S2/c1-20-10-7-9(8-11(21-2)13(10)22-3)14(17)15-16-24(18,19)12-5-4-6-23-12/h4-8,16H,1-3H3,(H,15,17) |
| InChIKey | HFHJNCCBEWMQBJ-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|