C17H18BrNO7S — CID 35532742
2-[(2-bromo-4-methylphenyl)sulfonylamino]-3,4,5-trimethoxybenzoic acid (PubChem CID 35532742) has the molecular formula C17H18BrNO7S and a molecular weight of 460.30 g/mol. Its IUPAC name is 2-[(2-bromo-4-methylphenyl)sulfonylamino]-3,4,5-trimethoxybenzoic acid.
| Compound Name | 2-[(2-bromo-4-methylphenyl)sulfonylamino]-3,4,5-trimethoxybenzoic acid |
|---|---|
| PubChem CID | 35532742 |
| Molecular Formula | C17H18BrNO7S |
| Molecular Weight | 460.30 g/mol |
| Exact Mass | 459.00 |
| IUPAC Name | 2-[(2-bromo-4-methylphenyl)sulfonylamino]-3,4,5-trimethoxybenzoic acid |
| SMILES | COc1cc(C(=O)O)c(NS(=O)(=O)c2ccc(C)cc2Br)c(OC)c1OC |
| InChI | InChI=1S/C17H18BrNO7S/c1-9-5-6-13(11(18)7-9)27(22,23)19-14-10(17(20)21)8-12(24-2)15(25-3)16(14)26-4/h5-8,19H,1-4H3,(H,20,21) |
| InChIKey | IMVPZSDJMUUUSE-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.30 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |