C15H16BrNO4S — CID 22773975
N-(2-bromo-4-methylphenyl)-2,4-dimethoxybenzenesulfonamide (PubChem CID 22773975) has the molecular formula C15H16BrNO4S and a molecular weight of 386.27 g/mol. Its IUPAC name is N-(2-bromo-4-methylphenyl)-2,4-dimethoxybenzenesulfonamide.
| Compound Name | N-(2-bromo-4-methylphenyl)-2,4-dimethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 22773975 |
| Molecular Formula | C15H16BrNO4S |
| Molecular Weight | 386.27 g/mol |
| Exact Mass | 385.00 |
| IUPAC Name | N-(2-bromo-4-methylphenyl)-2,4-dimethoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2ccc(C)cc2Br)c(OC)c1 |
| InChI | InChI=1S/C15H16BrNO4S/c1-10-4-6-13(12(16)8-10)17-22(18,19)15-7-5-11(20-2)9-14(15)21-3/h4-9,17H,1-3H3 |
| InChIKey | GAFUQGIKMAHKOS-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.27 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |