C14H13BrClNO4S — CID 7514398
4-bromo-2-chloro-N-(2,4-dimethoxyphenyl)benzenesulfonamide (PubChem CID 7514398) has the molecular formula C14H13BrClNO4S and a molecular weight of 406.69 g/mol. Its IUPAC name is 4-bromo-2-chloro-N-(2,4-dimethoxyphenyl)benzenesulfonamide.
| Compound Name | 4-bromo-2-chloro-N-(2,4-dimethoxyphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 7514398 |
| Molecular Formula | C14H13BrClNO4S |
| Molecular Weight | 406.69 g/mol |
| Exact Mass | 404.94 |
| IUPAC Name | 4-bromo-2-chloro-N-(2,4-dimethoxyphenyl)benzenesulfonamide |
| SMILES | COc1ccc(NS(=O)(=O)c2ccc(Br)cc2Cl)c(OC)c1 |
| InChI | InChI=1S/C14H13BrClNO4S/c1-20-10-4-5-12(13(8-10)21-2)17-22(18,19)14-6-3-9(15)7-11(14)16/h3-8,17H,1-2H3 |
| InChIKey | UYSIBBMUEJOFJF-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.69 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |