C13H14BrN3O4S — CID 22515844
2-amino-5-bromo-N-(2,4-dimethoxyphenyl)pyridine-3-sulfonamide (PubChem CID 22515844) has the molecular formula C13H14BrN3O4S and a molecular weight of 388.24 g/mol. Its IUPAC name is 2-amino-5-bromo-N-(2,4-dimethoxyphenyl)pyridine-3-sulfonamide.
| Compound Name | 2-amino-5-bromo-N-(2,4-dimethoxyphenyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 22515844 |
| Molecular Formula | C13H14BrN3O4S |
| Molecular Weight | 388.24 g/mol |
| Exact Mass | 386.99 |
| IUPAC Name | 2-amino-5-bromo-N-(2,4-dimethoxyphenyl)pyridine-3-sulfonamide |
| SMILES | COc1ccc(NS(=O)(=O)c2cc(Br)cnc2N)c(OC)c1 |
| InChI | InChI=1S/C13H14BrN3O4S/c1-20-9-3-4-10(11(6-9)21-2)17-22(18,19)12-5-8(14)7-16-13(12)15/h3-7,17H,1-2H3,(H2,15,16) |
| InChIKey | AGYAXDLKSVIFIF-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 103.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.24 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |