C12H10Br2FN3O2S — CID 107593897
2-amino-5-bromo-N-(5-bromo-4-fluoro-2-methylphenyl)pyridine-3-sulfonamide (PubChem CID 107593897) has the molecular formula C12H10Br2FN3O2S and a molecular weight of 439.10 g/mol. Its IUPAC name is 2-amino-5-bromo-N-(5-bromo-4-fluoro-2-methylphenyl)pyridine-3-sulfonamide.
| Compound Name | 2-amino-5-bromo-N-(5-bromo-4-fluoro-2-methylphenyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 107593897 |
| Molecular Formula | C12H10Br2FN3O2S |
| Molecular Weight | 439.10 g/mol |
| Exact Mass | 436.88 |
| IUPAC Name | 2-amino-5-bromo-N-(5-bromo-4-fluoro-2-methylphenyl)pyridine-3-sulfonamide |
| SMILES | Cc1cc(F)c(Br)cc1NS(=O)(=O)c1cc(Br)cnc1N |
| InChI | InChI=1S/C12H10Br2FN3O2S/c1-6-2-9(15)8(14)4-10(6)18-21(19,20)11-3-7(13)5-17-12(11)16/h2-5,18H,1H3,(H2,16,17) |
| InChIKey | GEXYOPJVVWXGPH-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.10 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |