C11H7Br2F2N3O2S — CID 103844082
2-amino-5-bromo-N-(4-bromo-2,5-difluorophenyl)pyridine-3-sulfonamide (PubChem CID 103844082) has the molecular formula C11H7Br2F2N3O2S and a molecular weight of 443.07 g/mol. Its IUPAC name is 2-amino-5-bromo-N-(4-bromo-2,5-difluorophenyl)pyridine-3-sulfonamide.
| Compound Name | 2-amino-5-bromo-N-(4-bromo-2,5-difluorophenyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 103844082 |
| Molecular Formula | C11H7Br2F2N3O2S |
| Molecular Weight | 443.07 g/mol |
| Exact Mass | 440.86 |
| IUPAC Name | 2-amino-5-bromo-N-(4-bromo-2,5-difluorophenyl)pyridine-3-sulfonamide |
| SMILES | Nc1ncc(Br)cc1S(=O)(=O)Nc1cc(F)c(Br)cc1F |
| InChI | InChI=1S/C11H7Br2F2N3O2S/c12-5-1-10(11(16)17-4-5)21(19,20)18-9-3-7(14)6(13)2-8(9)15/h1-4,18H,(H2,16,17) |
| InChIKey | XAAPQUZRUCEMOY-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.07 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|