C14H13ClFNO4S — CID 110759387
5-chloro-N-(2,4-dimethoxyphenyl)-2-fluorobenzenesulfonamide (PubChem CID 110759387) has the molecular formula C14H13ClFNO4S and a molecular weight of 345.78 g/mol. Its IUPAC name is 5-chloro-N-(2,4-dimethoxyphenyl)-2-fluorobenzenesulfonamide.
| Compound Name | 5-chloro-N-(2,4-dimethoxyphenyl)-2-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 110759387 |
| Molecular Formula | C14H13ClFNO4S |
| Molecular Weight | 345.78 g/mol |
| Exact Mass | 345.02 |
| IUPAC Name | 5-chloro-N-(2,4-dimethoxyphenyl)-2-fluorobenzenesulfonamide |
| SMILES | COc1ccc(NS(=O)(=O)c2cc(Cl)ccc2F)c(OC)c1 |
| InChI | InChI=1S/C14H13ClFNO4S/c1-20-10-4-6-12(13(8-10)21-2)17-22(18,19)14-7-9(15)3-5-11(14)16/h3-8,17H,1-2H3 |
| InChIKey | ATGBLLDKZHQLMX-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.78 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |