C15H15ClN2O5S — CID 47077078
5-chloro-2-[(2,5-dimethoxyphenyl)sulfonylamino]benzamide (PubChem CID 47077078) has the molecular formula C15H15ClN2O5S and a molecular weight of 370.81 g/mol. Its IUPAC name is 5-chloro-2-[(2,5-dimethoxyphenyl)sulfonylamino]benzamide.
| Compound Name | 5-chloro-2-[(2,5-dimethoxyphenyl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 47077078 |
| Molecular Formula | C15H15ClN2O5S |
| Molecular Weight | 370.81 g/mol |
| Exact Mass | 370.04 |
| IUPAC Name | 5-chloro-2-[(2,5-dimethoxyphenyl)sulfonylamino]benzamide |
| SMILES | COc1ccc(OC)c(S(=O)(=O)Nc2ccc(Cl)cc2C(N)=O)c1 |
| InChI | InChI=1S/C15H15ClN2O5S/c1-22-10-4-6-13(23-2)14(8-10)24(20,21)18-12-5-3-9(16)7-11(12)15(17)19/h3-8,18H,1-2H3,(H2,17,19) |
| InChIKey | XAIISOAMTAISJD-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.81 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |