C23H22N2O5S2 — CID 39692796
ethyl (E)-3-[4-[[2-[4-(thiophen-2-ylsulfonylamino)phenyl]acetyl]amino]phenyl]prop-2-enoate (PubChem CID 39692796) has the molecular formula C23H22N2O5S2 and a molecular weight of 470.57 g/mol. Its IUPAC name is ethyl (E)-3-[4-[[2-[4-(thiophen-2-ylsulfonylamino)phenyl]acetyl]amino]phenyl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[4-[[2-[4-(thiophen-2-ylsulfonylamino)phenyl]acetyl]amino]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 39692796 |
| Molecular Formula | C23H22N2O5S2 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.10 |
| IUPAC Name | ethyl (E)-3-[4-[[2-[4-(thiophen-2-ylsulfonylamino)phenyl]acetyl]amino]phenyl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1ccc(NC(=O)Cc2ccc(NS(=O)(=O)c3cccs3)cc2)cc1 |
| InChI | InChI=1S/C23H22N2O5S2/c1-2-30-22(27)14-9-17-5-10-19(11-6-17)24-21(26)16-18-7-12-20(13-8-18)25-32(28,29)23-4-3-15-31-23/h3-15,25H,2,16H2,1H3,(H,24,26)/b14-9+ |
| InChIKey | GWBPZTXOAJGEHA-NTEUORMPSA-N |
| XLogP | 4.31 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|