C17H22N2O3S2 — CID 39266553
N-pentyl-2-[4-(thiophen-2-ylsulfonylamino)phenyl]acetamide (PubChem CID 39266553) has the molecular formula C17H22N2O3S2 and a molecular weight of 366.51 g/mol. Its IUPAC name is N-pentyl-2-[4-(thiophen-2-ylsulfonylamino)phenyl]acetamide.
| Compound Name | N-pentyl-2-[4-(thiophen-2-ylsulfonylamino)phenyl]acetamide |
|---|---|
| PubChem CID | 39266553 |
| Molecular Formula | C17H22N2O3S2 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | N-pentyl-2-[4-(thiophen-2-ylsulfonylamino)phenyl]acetamide |
| SMILES | CCCCCNC(=O)Cc1ccc(NS(=O)(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C17H22N2O3S2/c1-2-3-4-11-18-16(20)13-14-7-9-15(10-8-14)19-24(21,22)17-6-5-12-23-17/h5-10,12,19H,2-4,11,13H2,1H3,(H,18,20) |
| InChIKey | QXVZYVWOEMIJLY-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|