C20H18BrFN2O3S2 — CID 55955386
N-[2-(3-bromo-4-fluorophenyl)ethyl]-2-[4-(thiophen-2-ylsulfonylamino)phenyl]acetamide (PubChem CID 55955386) has the molecular formula C20H18BrFN2O3S2 and a molecular weight of 497.41 g/mol. Its IUPAC name is N-[2-(3-bromo-4-fluorophenyl)ethyl]-2-[4-(thiophen-2-ylsulfonylamino)phenyl]acetamide.
| Compound Name | N-[2-(3-bromo-4-fluorophenyl)ethyl]-2-[4-(thiophen-2-ylsulfonylamino)phenyl]acetamide |
|---|---|
| PubChem CID | 55955386 |
| Molecular Formula | C20H18BrFN2O3S2 |
| Molecular Weight | 497.41 g/mol |
| Exact Mass | 495.99 |
| IUPAC Name | N-[2-(3-bromo-4-fluorophenyl)ethyl]-2-[4-(thiophen-2-ylsulfonylamino)phenyl]acetamide |
| SMILES | O=C(Cc1ccc(NS(=O)(=O)c2cccs2)cc1)NCCc1ccc(F)c(Br)c1 |
| InChI | InChI=1S/C20H18BrFN2O3S2/c21-17-12-15(5-8-18(17)22)9-10-23-19(25)13-14-3-6-16(7-4-14)24-29(26,27)20-2-1-11-28-20/h1-8,11-12,24H,9-10,13H2,(H,23,25) |
| InChIKey | ZRWWWNGMTXSMHQ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.41 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |