C15H20ClN3O3S2 — CID 119408784
N-(3-aminopropyl)-2-[4-(thiophen-2-ylsulfonylamino)phenyl]acetamide;hydrochloride (PubChem CID 119408784) has the molecular formula C15H20ClN3O3S2 and a molecular weight of 389.93 g/mol. Its IUPAC name is N-(3-aminopropyl)-2-[4-(thiophen-2-ylsulfonylamino)phenyl]acetamide;hydrochloride.
| Compound Name | N-(3-aminopropyl)-2-[4-(thiophen-2-ylsulfonylamino)phenyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 119408784 |
| Molecular Formula | C15H20ClN3O3S2 |
| Molecular Weight | 389.93 g/mol |
| Exact Mass | 389.06 |
| IUPAC Name | N-(3-aminopropyl)-2-[4-(thiophen-2-ylsulfonylamino)phenyl]acetamide;hydrochloride |
| SMILES | Cl.NCCCNC(=O)Cc1ccc(NS(=O)(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C15H19N3O3S2.ClH/c16-8-2-9-17-14(19)11-12-4-6-13(7-5-12)18-23(20,21)15-3-1-10-22-15;/h1,3-7,10,18H,2,8-9,11,16H2,(H,17,19);1H |
| InChIKey | MQBHICNDMJDWJA-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.93 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|