C20H19NO6 — CID 15986589
N-[7-methoxy-6-[(E)-3-(4-methoxyphenyl)-3-oxoprop-1-enyl]-1,3-benzodioxol-5-yl]acetamide (PubChem CID 15986589) has the molecular formula C20H19NO6 and a molecular weight of 369.37 g/mol. Its IUPAC name is N-[7-methoxy-6-[(E)-3-(4-methoxyphenyl)-3-oxoprop-1-enyl]-1,3-benzodioxol-5-yl]acetamide.
| Compound Name | N-[7-methoxy-6-[(E)-3-(4-methoxyphenyl)-3-oxoprop-1-enyl]-1,3-benzodioxol-5-yl]acetamide |
|---|---|
| PubChem CID | 15986589 |
| Molecular Formula | C20H19NO6 |
| Molecular Weight | 369.37 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | N-[7-methoxy-6-[(E)-3-(4-methoxyphenyl)-3-oxoprop-1-enyl]-1,3-benzodioxol-5-yl]acetamide |
| SMILES | COc1ccc(C(=O)/C=C/c2c(NC(C)=O)cc3c(c2OC)OCO3)cc1 |
| InChI | InChI=1S/C20H19NO6/c1-12(22)21-16-10-18-20(27-11-26-18)19(25-3)15(16)8-9-17(23)13-4-6-14(24-2)7-5-13/h4-10H,11H2,1-3H3,(H,21,22)/b9-8+ |
| InChIKey | VQUNMIUHXHUHLT-CMDGGOBGSA-N |
| XLogP | 3.29 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.37 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|