C11H11NO5 — CID 84798418
N-(6-formyl-5-methoxy-1,3-benzodioxol-4-yl)acetamide (PubChem CID 84798418) has the molecular formula C11H11NO5 and a molecular weight of 237.21 g/mol. Its IUPAC name is N-(6-formyl-5-methoxy-1,3-benzodioxol-4-yl)acetamide.
| Compound Name | N-(6-formyl-5-methoxy-1,3-benzodioxol-4-yl)acetamide |
|---|---|
| PubChem CID | 84798418 |
| Molecular Formula | C11H11NO5 |
| Molecular Weight | 237.21 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | N-(6-formyl-5-methoxy-1,3-benzodioxol-4-yl)acetamide |
| SMILES | COc1c(C=O)cc2c(c1NC(C)=O)OCO2 |
| InChI | InChI=1S/C11H11NO5/c1-6(14)12-9-10(15-2)7(4-13)3-8-11(9)17-5-16-8/h3-4H,5H2,1-2H3,(H,12,14) |
| InChIKey | KBLMIILYWJKFBD-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.21 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|