C10H9BrO4 — CID 84713456
1-(7-bromo-6-methoxy-1,3-benzodioxol-5-yl)ethanone (PubChem CID 84713456) has the molecular formula C10H9BrO4 and a molecular weight of 273.08 g/mol. Its IUPAC name is 1-(7-bromo-6-methoxy-1,3-benzodioxol-5-yl)ethanone.
| Compound Name | 1-(7-bromo-6-methoxy-1,3-benzodioxol-5-yl)ethanone |
|---|---|
| PubChem CID | 84713456 |
| Molecular Formula | C10H9BrO4 |
| Molecular Weight | 273.08 g/mol |
| Exact Mass | 271.97 |
| IUPAC Name | 1-(7-bromo-6-methoxy-1,3-benzodioxol-5-yl)ethanone |
| SMILES | COc1c(C(C)=O)cc2c(c1Br)OCO2 |
| InChI | InChI=1S/C10H9BrO4/c1-5(12)6-3-7-10(15-4-14-7)8(11)9(6)13-2/h3H,4H2,1-2H3 |
| InChIKey | KVVGBGPSYULFDX-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.08 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |