C18H16O5 — CID 166436406
(E)-1-(7-methoxy-1,3-benzodioxol-5-yl)-3-(4-methoxyphenyl)prop-2-en-1-one (PubChem CID 166436406) has the molecular formula C18H16O5 and a molecular weight of 312.32 g/mol. Its IUPAC name is (E)-1-(7-methoxy-1,3-benzodioxol-5-yl)-3-(4-methoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-(7-methoxy-1,3-benzodioxol-5-yl)-3-(4-methoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 166436406 |
| Molecular Formula | C18H16O5 |
| Molecular Weight | 312.32 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | (E)-1-(7-methoxy-1,3-benzodioxol-5-yl)-3-(4-methoxyphenyl)prop-2-en-1-one |
| SMILES | COc1ccc(/C=C/C(=O)c2cc(OC)c3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C18H16O5/c1-20-14-6-3-12(4-7-14)5-8-15(19)13-9-16(21-2)18-17(10-13)22-11-23-18/h3-10H,11H2,1-2H3/b8-5+ |
| InChIKey | AENGACXAVZQZDI-VMPITWQZSA-N |
| XLogP | 3.33 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.32 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|