C22H26NO3+ — CID 8830045
(E)-3-(4-methoxyphenyl)-1-[4-methoxy-3-(pyrrolidin-1-ium-1-ylmethyl)phenyl]prop-2-en-1-one (PubChem CID 8830045) has the molecular formula C22H26NO3+ and a molecular weight of 352.45 g/mol. Its IUPAC name is (E)-3-(4-methoxyphenyl)-1-[4-methoxy-3-(pyrrolidin-1-ium-1-ylmethyl)phenyl]prop-2-en-1-one.
| Compound Name | (E)-3-(4-methoxyphenyl)-1-[4-methoxy-3-(pyrrolidin-1-ium-1-ylmethyl)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 8830045 |
| Molecular Formula | C22H26NO3+ |
| Molecular Weight | 352.45 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | (E)-3-(4-methoxyphenyl)-1-[4-methoxy-3-(pyrrolidin-1-ium-1-ylmethyl)phenyl]prop-2-en-1-one |
| SMILES | COc1ccc(/C=C/C(=O)c2ccc(OC)c(C[NH+]3CCCC3)c2)cc1 |
| InChI | InChI=1S/C22H25NO3/c1-25-20-9-5-17(6-10-20)7-11-21(24)18-8-12-22(26-2)19(15-18)16-23-13-3-4-14-23/h5-12,15H,3-4,13-14,16H2,1-2H3/p+1/b11-7+ |
| InChIKey | ZQQUQBNICNHAIT-YRNVUSSQSA-O |
| XLogP | 2.78 |
| TPSA | 39.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.45 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|