C22H29ClN2O3 — CID 6519103
(E)-1-[3,5-bis[(dimethylamino)methyl]-4-hydroxyphenyl]-3-(4-methoxyphenyl)prop-2-en-1-one;hydrochloride (PubChem CID 6519103) has the molecular formula C22H29ClN2O3 and a molecular weight of 404.94 g/mol. Its IUPAC name is (E)-1-[3,5-bis[(dimethylamino)methyl]-4-hydroxyphenyl]-3-(4-methoxyphenyl)prop-2-en-1-one;hydrochloride.
| Compound Name | (E)-1-[3,5-bis[(dimethylamino)methyl]-4-hydroxyphenyl]-3-(4-methoxyphenyl)prop-2-en-1-one;hydrochloride |
|---|---|
| PubChem CID | 6519103 |
| Molecular Formula | C22H29ClN2O3 |
| Molecular Weight | 404.94 g/mol |
| Exact Mass | 404.19 |
| IUPAC Name | (E)-1-[3,5-bis[(dimethylamino)methyl]-4-hydroxyphenyl]-3-(4-methoxyphenyl)prop-2-en-1-one;hydrochloride |
| SMILES | COc1ccc(/C=C/C(=O)c2cc(CN(C)C)c(O)c(CN(C)C)c2)cc1.Cl |
| InChI | InChI=1S/C22H28N2O3.ClH/c1-23(2)14-18-12-17(13-19(22(18)26)15-24(3)4)21(25)11-8-16-6-9-20(27-5)10-7-16;/h6-13,26H,14-15H2,1-5H3;1H/b11-8+; |
| InChIKey | FBQCTQBPNRFTEU-YGCVIUNWSA-N |
| XLogP | 3.84 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.94 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|