About [4-[(E)-prop-1-enyl]-1,3-benzodioxol-5-yl]-pyrrolidin-1-ylmethanone
[4-[(E)-prop-1-enyl]-1,3-benzodioxol-5-yl]-pyrrolidin-1-ylmethanone (PubChem CID 132965762) has the molecular formula C15H17NO3
and a molecular weight of 259.31 g/mol. Its IUPAC name is [4-[(E)-prop-1-enyl]-1,3-benzodioxol-5-yl]-pyrrolidin-1-ylmethanone.
Molecular Properties
| Compound Name | [4-[(E)-prop-1-enyl]-1,3-benzodioxol-5-yl]-pyrrolidin-1-ylmethanone |
| PubChem CID | 132965762 |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | [4-[(E)-prop-1-enyl]-1,3-benzodioxol-5-yl]-pyrrolidin-1-ylmethanone |
| SMILES | C/C=C/c1c(C(=O)N2CCCC2)ccc2c1OCO2 |
| InChI | InChI=1S/C15H17NO3/c1-2-5-11-12(15(17)16-8-3-4-9-16)6-7-13-14(11)19-10-18-13/h2,5-7H,3-4,8-10H2,1H3/b5-2+ |
| InChIKey | GYKAPEJBTPLIQO-GORDUTHDSA-N |
| XLogP | 2.68 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [4-[(E)-prop-1-enyl]-1,3-benzodioxol-5-yl]-pyrrolidin-1-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(E)-prop-1-enyl]-1,3-benzodioxol-5-yl]-pyrrolidin-1-ylmethanone?
The IUPAC name of [4-[(E)-prop-1-enyl]-1,3-benzodioxol-5-yl]-pyrrolidin-1-ylmethanone (CID 132965762) is [4-[(E)-prop-1-enyl]-1,3-benzodioxol-5-yl]-pyrrolidin-1-ylmethanone.
What is the SMILES notation for [4-[(E)-prop-1-enyl]-1,3-benzodioxol-5-yl]-pyrrolidin-1-ylmethanone?
The canonical SMILES for [4-[(E)-prop-1-enyl]-1,3-benzodioxol-5-yl]-pyrrolidin-1-ylmethanone is C/C=C/c1c(C(=O)N2CCCC2)ccc2c1OCO2.
What is the InChIKey of [4-[(E)-prop-1-enyl]-1,3-benzodioxol-5-yl]-pyrrolidin-1-ylmethanone?
The InChIKey is GYKAPEJBTPLIQO-GORDUTHDSA-N. The full InChI is InChI=1S/C15H17NO3/c1-2-5-11-12(15(17)16-8-3-4-9-16)6-7-13-14(11)19-10-18-13/h2,5-7H,3-4,8-10H2,1H3/b5-2+.
What are the key properties of [4-[(E)-prop-1-enyl]-1,3-benzodioxol-5-yl]-pyrrolidin-1-ylmethanone?
[4-[(E)-prop-1-enyl]-1,3-benzodioxol-5-yl]-pyrrolidin-1-ylmethanone has a molecular weight of 259.31 g/mol, XLogP of 2.68, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(E)-prop-1-enyl]-1,3-benzodioxol-5-yl]-pyrrolidin-1-ylmethanone is sourced from PubChem (CID 132965762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).