C14H16ClNO3 — CID 9401585
azepan-1-yl-(7-chloro-1,3-benzodioxol-5-yl)methanone (PubChem CID 9401585) has the molecular formula C14H16ClNO3 and a molecular weight of 281.74 g/mol. Its IUPAC name is azepan-1-yl-(7-chloro-1,3-benzodioxol-5-yl)methanone.
| Compound Name | azepan-1-yl-(7-chloro-1,3-benzodioxol-5-yl)methanone |
|---|---|
| PubChem CID | 9401585 |
| Molecular Formula | C14H16ClNO3 |
| Molecular Weight | 281.74 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | azepan-1-yl-(7-chloro-1,3-benzodioxol-5-yl)methanone |
| SMILES | O=C(c1cc(Cl)c2c(c1)OCO2)N1CCCCCC1 |
| InChI | InChI=1S/C14H16ClNO3/c15-11-7-10(8-12-13(11)19-9-18-12)14(17)16-5-3-1-2-4-6-16/h7-8H,1-6,9H2 |
| InChIKey | YEFWBGNVXMUYAF-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.74 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |