C19H19ClN2O3 — CID 9402325
(4-benzylpiperazin-1-yl)-(7-chloro-1,3-benzodioxol-5-yl)methanone (PubChem CID 9402325) has the molecular formula C19H19ClN2O3 and a molecular weight of 358.83 g/mol. Its IUPAC name is (4-benzylpiperazin-1-yl)-(7-chloro-1,3-benzodioxol-5-yl)methanone.
| Compound Name | (4-benzylpiperazin-1-yl)-(7-chloro-1,3-benzodioxol-5-yl)methanone |
|---|---|
| PubChem CID | 9402325 |
| Molecular Formula | C19H19ClN2O3 |
| Molecular Weight | 358.83 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | (4-benzylpiperazin-1-yl)-(7-chloro-1,3-benzodioxol-5-yl)methanone |
| SMILES | O=C(c1cc(Cl)c2c(c1)OCO2)N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C19H19ClN2O3/c20-16-10-15(11-17-18(16)25-13-24-17)19(23)22-8-6-21(7-9-22)12-14-4-2-1-3-5-14/h1-5,10-11H,6-9,12-13H2 |
| InChIKey | MKUOCGFYLZHYKC-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.83 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |