C11H10O5 — CID 71605511
methyl (E)-3-(5-hydroxy-1,3-benzodioxol-4-yl)prop-2-enoate (PubChem CID 71605511) has the molecular formula C11H10O5 and a molecular weight of 222.20 g/mol. Its IUPAC name is methyl (E)-3-(5-hydroxy-1,3-benzodioxol-4-yl)prop-2-enoate.
| Compound Name | methyl (E)-3-(5-hydroxy-1,3-benzodioxol-4-yl)prop-2-enoate |
|---|---|
| PubChem CID | 71605511 |
| Molecular Formula | C11H10O5 |
| Molecular Weight | 222.20 g/mol |
| Exact Mass | 222.05 |
| IUPAC Name | methyl (E)-3-(5-hydroxy-1,3-benzodioxol-4-yl)prop-2-enoate |
| SMILES | COC(=O)/C=C/c1c(O)ccc2c1OCO2 |
| InChI | InChI=1S/C11H10O5/c1-14-10(13)5-2-7-8(12)3-4-9-11(7)16-6-15-9/h2-5,12H,6H2,1H3/b5-2+ |
| InChIKey | ZKMJCODFIFXNQE-GORDUTHDSA-N |
| XLogP | 1.31 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.20 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|