C18H14O6 — CID 102253518
methyl (E)-3-[6-(1,3-benzodioxol-5-yl)-1,3-benzodioxol-5-yl]prop-2-enoate (PubChem CID 102253518) has the molecular formula C18H14O6 and a molecular weight of 326.30 g/mol. Its IUPAC name is methyl (E)-3-[6-(1,3-benzodioxol-5-yl)-1,3-benzodioxol-5-yl]prop-2-enoate.
| Compound Name | methyl (E)-3-[6-(1,3-benzodioxol-5-yl)-1,3-benzodioxol-5-yl]prop-2-enoate |
|---|---|
| PubChem CID | 102253518 |
| Molecular Formula | C18H14O6 |
| Molecular Weight | 326.30 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | methyl (E)-3-[6-(1,3-benzodioxol-5-yl)-1,3-benzodioxol-5-yl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1cc2c(cc1-c1ccc3c(c1)OCO3)OCO2 |
| InChI | InChI=1S/C18H14O6/c1-20-18(19)5-3-12-7-16-17(24-10-23-16)8-13(12)11-2-4-14-15(6-11)22-9-21-14/h2-8H,9-10H2,1H3/b5-3+ |
| InChIKey | BMIIHEWNKCRMEQ-HWKANZROSA-N |
| XLogP | 3.00 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.30 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|