C17H16O6 — CID 39234088
6-(1,3-benzodioxol-5-yl)-2,3,4-trimethoxybenzaldehyde (PubChem CID 39234088) has the molecular formula C17H16O6 and a molecular weight of 316.31 g/mol. Its IUPAC name is 6-(1,3-benzodioxol-5-yl)-2,3,4-trimethoxybenzaldehyde.
| Compound Name | 6-(1,3-benzodioxol-5-yl)-2,3,4-trimethoxybenzaldehyde |
|---|---|
| PubChem CID | 39234088 |
| Molecular Formula | C17H16O6 |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | 6-(1,3-benzodioxol-5-yl)-2,3,4-trimethoxybenzaldehyde |
| SMILES | COc1cc(-c2ccc3c(c2)OCO3)c(C=O)c(OC)c1OC |
| InChI | InChI=1S/C17H16O6/c1-19-15-7-11(12(8-18)16(20-2)17(15)21-3)10-4-5-13-14(6-10)23-9-22-13/h4-8H,9H2,1-3H3 |
| InChIKey | FAWOBUSFCBYNAC-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.31 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|