C21H25NO5 — CID 39234415
2,3,4-trimethoxy-6-[4-(morpholin-4-ylmethyl)phenyl]benzaldehyde (PubChem CID 39234415) has the molecular formula C21H25NO5 and a molecular weight of 371.43 g/mol. Its IUPAC name is 2,3,4-trimethoxy-6-[4-(morpholin-4-ylmethyl)phenyl]benzaldehyde.
| Compound Name | 2,3,4-trimethoxy-6-[4-(morpholin-4-ylmethyl)phenyl]benzaldehyde |
|---|---|
| PubChem CID | 39234415 |
| Molecular Formula | C21H25NO5 |
| Molecular Weight | 371.43 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | 2,3,4-trimethoxy-6-[4-(morpholin-4-ylmethyl)phenyl]benzaldehyde |
| SMILES | COc1cc(-c2ccc(CN3CCOCC3)cc2)c(C=O)c(OC)c1OC |
| InChI | InChI=1S/C21H25NO5/c1-24-19-12-17(18(14-23)20(25-2)21(19)26-3)16-6-4-15(5-7-16)13-22-8-10-27-11-9-22/h4-7,12,14H,8-11,13H2,1-3H3 |
| InChIKey | QIEUMFDHNDCYGY-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.43 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|