C8H7NO3 — CID 136650765
4-methanimidoyl-1,3-benzodioxol-5-ol (PubChem CID 136650765) has the molecular formula C8H7NO3 and a molecular weight of 165.15 g/mol. Its IUPAC name is 4-methanimidoyl-1,3-benzodioxol-5-ol.
| Compound Name | 4-methanimidoyl-1,3-benzodioxol-5-ol |
|---|---|
| PubChem CID | 136650765 |
| Molecular Formula | C8H7NO3 |
| Molecular Weight | 165.15 g/mol |
| Exact Mass | 165.04 |
| IUPAC Name | 4-methanimidoyl-1,3-benzodioxol-5-ol |
| SMILES | [H]/N=C/c1c(O)ccc2c1OCO2 |
| InChI | InChI=1S/C8H7NO3/c9-3-5-6(10)1-2-7-8(5)12-4-11-7/h1-3,9-10H,4H2/b9-3+ |
| InChIKey | QEDQSONBNTYMQO-YCRREMRBSA-N |
| XLogP | 1.12 |
| TPSA | 62.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.15 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|