C8H6BrNO2 — CID 90950974
(5-bromo-1,3-benzodioxol-4-yl)methanimine (PubChem CID 90950974) has the molecular formula C8H6BrNO2 and a molecular weight of 228.04 g/mol. Its IUPAC name is (5-bromo-1,3-benzodioxol-4-yl)methanimine.
| Compound Name | (5-bromo-1,3-benzodioxol-4-yl)methanimine |
|---|---|
| PubChem CID | 90950974 |
| Molecular Formula | C8H6BrNO2 |
| Molecular Weight | 228.04 g/mol |
| Exact Mass | 226.96 |
| IUPAC Name | (5-bromo-1,3-benzodioxol-4-yl)methanimine |
| SMILES | [H]/N=C/c1c(Br)ccc2c1OCO2 |
| InChI | InChI=1S/C8H6BrNO2/c9-6-1-2-7-8(5(6)3-10)12-4-11-7/h1-3,10H,4H2/b10-3+ |
| InChIKey | RIHPJIPNZHNALU-XCVCLJGOSA-N |
| XLogP | 2.18 |
| TPSA | 42.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.04 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|