C8H6BrNO3 — CID 91808152
5-bromo-4-(nitrosomethyl)-1,3-benzodioxole (PubChem CID 91808152) has the molecular formula C8H6BrNO3 and a molecular weight of 244.04 g/mol. Its IUPAC name is 5-bromo-4-(nitrosomethyl)-1,3-benzodioxole.
| Compound Name | 5-bromo-4-(nitrosomethyl)-1,3-benzodioxole |
|---|---|
| PubChem CID | 91808152 |
| Molecular Formula | C8H6BrNO3 |
| Molecular Weight | 244.04 g/mol |
| Exact Mass | 242.95 |
| IUPAC Name | 5-bromo-4-(nitrosomethyl)-1,3-benzodioxole |
| SMILES | O=NCc1c(Br)ccc2c1OCO2 |
| InChI | InChI=1S/C8H6BrNO3/c9-6-1-2-7-8(13-4-12-7)5(6)3-10-11/h1-2H,3-4H2 |
| InChIKey | XSBKDHVZNIADMC-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.04 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |