C9H6BrNO3 — CID 117393141
5-bromo-4-(isocyanatomethyl)-1,3-benzodioxole (PubChem CID 117393141) has the molecular formula C9H6BrNO3 and a molecular weight of 256.05 g/mol. Its IUPAC name is 5-bromo-4-(isocyanatomethyl)-1,3-benzodioxole.
| Compound Name | 5-bromo-4-(isocyanatomethyl)-1,3-benzodioxole |
|---|---|
| PubChem CID | 117393141 |
| Molecular Formula | C9H6BrNO3 |
| Molecular Weight | 256.05 g/mol |
| Exact Mass | 254.95 |
| IUPAC Name | 5-bromo-4-(isocyanatomethyl)-1,3-benzodioxole |
| SMILES | O=C=NCc1c(Br)ccc2c1OCO2 |
| InChI | InChI=1S/C9H6BrNO3/c10-7-1-2-8-9(14-5-13-8)6(7)3-11-4-12/h1-2H,3,5H2 |
| InChIKey | SJDBRMBAUXVONO-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.05 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|