C12H10BrNO3 — CID 117476915
5-bromo-4-(1-isocyanatocyclobutyl)-1,3-benzodioxole (PubChem CID 117476915) has the molecular formula C12H10BrNO3 and a molecular weight of 296.12 g/mol. Its IUPAC name is 5-bromo-4-(1-isocyanatocyclobutyl)-1,3-benzodioxole.
| Compound Name | 5-bromo-4-(1-isocyanatocyclobutyl)-1,3-benzodioxole |
|---|---|
| PubChem CID | 117476915 |
| Molecular Formula | C12H10BrNO3 |
| Molecular Weight | 296.12 g/mol |
| Exact Mass | 294.98 |
| IUPAC Name | 5-bromo-4-(1-isocyanatocyclobutyl)-1,3-benzodioxole |
| SMILES | O=C=NC1(c2c(Br)ccc3c2OCO3)CCC1 |
| InChI | InChI=1S/C12H10BrNO3/c13-8-2-3-9-11(17-7-16-9)10(8)12(14-6-15)4-1-5-12/h2-3H,1,4-5,7H2 |
| InChIKey | IHRBAJLXGIUVNI-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.12 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|