C13H14BrNO — CID 117449466
1-bromo-2-(1-isocyanatocyclobutyl)-3,4-dimethylbenzene (PubChem CID 117449466) has the molecular formula C13H14BrNO and a molecular weight of 280.16 g/mol. Its IUPAC name is 1-bromo-2-(1-isocyanatocyclobutyl)-3,4-dimethylbenzene.
| Compound Name | 1-bromo-2-(1-isocyanatocyclobutyl)-3,4-dimethylbenzene |
|---|---|
| PubChem CID | 117449466 |
| Molecular Formula | C13H14BrNO |
| Molecular Weight | 280.16 g/mol |
| Exact Mass | 279.03 |
| IUPAC Name | 1-bromo-2-(1-isocyanatocyclobutyl)-3,4-dimethylbenzene |
| SMILES | Cc1ccc(Br)c(C2(N=C=O)CCC2)c1C |
| InChI | InChI=1S/C13H14BrNO/c1-9-4-5-11(14)12(10(9)2)13(15-8-16)6-3-7-13/h4-5H,3,6-7H2,1-2H3 |
| InChIKey | WNFKAUKUCBJABL-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.16 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|