C15H19NO2 — CID 117365399
2-ethoxy-1-(1-isocyanatocyclobutyl)-3,4-dimethylbenzene (PubChem CID 117365399) has the molecular formula C15H19NO2 and a molecular weight of 245.32 g/mol. Its IUPAC name is 2-ethoxy-1-(1-isocyanatocyclobutyl)-3,4-dimethylbenzene.
| Compound Name | 2-ethoxy-1-(1-isocyanatocyclobutyl)-3,4-dimethylbenzene |
|---|---|
| PubChem CID | 117365399 |
| Molecular Formula | C15H19NO2 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | 2-ethoxy-1-(1-isocyanatocyclobutyl)-3,4-dimethylbenzene |
| SMILES | CCOc1c(C2(N=C=O)CCC2)ccc(C)c1C |
| InChI | InChI=1S/C15H19NO2/c1-4-18-14-12(3)11(2)6-7-13(14)15(16-10-17)8-5-9-15/h6-7H,4-5,8-9H2,1-3H3 |
| InChIKey | ZRNZMJAHWVOOIP-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|