C14H15NO — CID 117304389
4-(1-isocyanatocyclopropyl)-7-methyl-2,3-dihydro-1H-indene (PubChem CID 117304389) has the molecular formula C14H15NO and a molecular weight of 213.28 g/mol. Its IUPAC name is 4-(1-isocyanatocyclopropyl)-7-methyl-2,3-dihydro-1H-indene.
| Compound Name | 4-(1-isocyanatocyclopropyl)-7-methyl-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 117304389 |
| Molecular Formula | C14H15NO |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.12 |
| IUPAC Name | 4-(1-isocyanatocyclopropyl)-7-methyl-2,3-dihydro-1H-indene |
| SMILES | Cc1ccc(C2(N=C=O)CC2)c2c1CCC2 |
| InChI | InChI=1S/C14H15NO/c1-10-5-6-13(12-4-2-3-11(10)12)14(7-8-14)15-9-16/h5-6H,2-4,7-8H2,1H3 |
| InChIKey | REQRJFNRSQKZMT-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|