C14H16BrNO2 — CID 117494889
5-bromo-2-(1-isocyanatocyclopentyl)-3,6-dimethylphenol (PubChem CID 117494889) has the molecular formula C14H16BrNO2 and a molecular weight of 310.19 g/mol. Its IUPAC name is 5-bromo-2-(1-isocyanatocyclopentyl)-3,6-dimethylphenol.
| Compound Name | 5-bromo-2-(1-isocyanatocyclopentyl)-3,6-dimethylphenol |
|---|---|
| PubChem CID | 117494889 |
| Molecular Formula | C14H16BrNO2 |
| Molecular Weight | 310.19 g/mol |
| Exact Mass | 309.04 |
| IUPAC Name | 5-bromo-2-(1-isocyanatocyclopentyl)-3,6-dimethylphenol |
| SMILES | Cc1cc(Br)c(C)c(O)c1C1(N=C=O)CCCC1 |
| InChI | InChI=1S/C14H16BrNO2/c1-9-7-11(15)10(2)13(18)12(9)14(16-8-17)5-3-4-6-14/h7,18H,3-6H2,1-2H3 |
| InChIKey | VLSGLPDERCBPRG-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.19 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|