C11H15BrClNO2 — CID 170889163
1-(5-bromo-1,3-benzodioxol-4-yl)butan-2-amine;hydrochloride (PubChem CID 170889163) has the molecular formula C11H15BrClNO2 and a molecular weight of 308.60 g/mol. Its IUPAC name is 1-(5-bromo-1,3-benzodioxol-4-yl)butan-2-amine;hydrochloride.
| Compound Name | 1-(5-bromo-1,3-benzodioxol-4-yl)butan-2-amine;hydrochloride |
|---|---|
| PubChem CID | 170889163 |
| Molecular Formula | C11H15BrClNO2 |
| Molecular Weight | 308.60 g/mol |
| Exact Mass | 307.00 |
| IUPAC Name | 1-(5-bromo-1,3-benzodioxol-4-yl)butan-2-amine;hydrochloride |
| SMILES | CCC(N)Cc1c(Br)ccc2c1OCO2.Cl |
| InChI | InChI=1S/C11H14BrNO2.ClH/c1-2-7(13)5-8-9(12)3-4-10-11(8)15-6-14-10;/h3-4,7H,2,5-6,13H2,1H3;1H |
| InChIKey | IOWOQAMLRNCWDK-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.60 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |