C11H15NO3 — CID 117298689
1-[4-(methoxymethyl)-1,3-benzodioxol-5-yl]ethanamine (PubChem CID 117298689) has the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. Its IUPAC name is 1-[4-(methoxymethyl)-1,3-benzodioxol-5-yl]ethanamine.
| Compound Name | 1-[4-(methoxymethyl)-1,3-benzodioxol-5-yl]ethanamine |
|---|---|
| PubChem CID | 117298689 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | 1-[4-(methoxymethyl)-1,3-benzodioxol-5-yl]ethanamine |
| SMILES | COCc1c(C(C)N)ccc2c1OCO2 |
| InChI | InChI=1S/C11H15NO3/c1-7(12)8-3-4-10-11(15-6-14-10)9(8)5-13-2/h3-4,7H,5-6,12H2,1-2H3 |
| InChIKey | FAXRWTGKRNIQRP-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |