C11H15NO4S — CID 117396524
1-(4-methylsulfonyl-1,3-benzodioxol-5-yl)propan-2-amine (PubChem CID 117396524) has the molecular formula C11H15NO4S and a molecular weight of 257.31 g/mol. Its IUPAC name is 1-(4-methylsulfonyl-1,3-benzodioxol-5-yl)propan-2-amine.
| Compound Name | 1-(4-methylsulfonyl-1,3-benzodioxol-5-yl)propan-2-amine |
|---|---|
| PubChem CID | 117396524 |
| Molecular Formula | C11H15NO4S |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | 1-(4-methylsulfonyl-1,3-benzodioxol-5-yl)propan-2-amine |
| SMILES | CC(N)Cc1ccc2c(c1S(C)(=O)=O)OCO2 |
| InChI | InChI=1S/C11H15NO4S/c1-7(12)5-8-3-4-9-10(16-6-15-9)11(8)17(2,13)14/h3-4,7H,5-6,12H2,1-2H3 |
| InChIKey | YSLAPJPKZZERSI-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |