C9H11NO3 — CID 130739560
5-[(1R)-1-aminoethyl]-1,3-benzodioxol-4-ol (PubChem CID 130739560) has the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. Its IUPAC name is 5-[(1R)-1-aminoethyl]-1,3-benzodioxol-4-ol.
| Compound Name | 5-[(1R)-1-aminoethyl]-1,3-benzodioxol-4-ol |
|---|---|
| PubChem CID | 130739560 |
| Molecular Formula | C9H11NO3 |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.07 |
| IUPAC Name | 5-[(1R)-1-aminoethyl]-1,3-benzodioxol-4-ol |
| SMILES | C[C@@H](N)c1ccc2c(c1O)OCO2 |
| InChI | InChI=1S/C9H11NO3/c1-5(10)6-2-3-7-9(8(6)11)13-4-12-7/h2-3,5,11H,4,10H2,1H3/t5-/m1/s1 |
| InChIKey | BYECQZNPGODBPY-RXMQYKEDSA-N |
| XLogP | 1.14 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|