C10H13NO4 — CID 117301123
5-[1-hydroxy-2-(methylamino)ethyl]-1,3-benzodioxol-4-ol (PubChem CID 117301123) has the molecular formula C10H13NO4 and a molecular weight of 211.22 g/mol. Its IUPAC name is 5-[1-hydroxy-2-(methylamino)ethyl]-1,3-benzodioxol-4-ol.
| Compound Name | 5-[1-hydroxy-2-(methylamino)ethyl]-1,3-benzodioxol-4-ol |
|---|---|
| PubChem CID | 117301123 |
| Molecular Formula | C10H13NO4 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 5-[1-hydroxy-2-(methylamino)ethyl]-1,3-benzodioxol-4-ol |
| SMILES | CNCC(O)c1ccc2c(c1O)OCO2 |
| InChI | InChI=1S/C10H13NO4/c1-11-4-7(12)6-2-3-8-10(9(6)13)15-5-14-8/h2-3,7,11-13H,4-5H2,1H3 |
| InChIKey | RNRQTIGVFHBSMS-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 70.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |