C11H15NO4 — CID 117323117
1-(6-methoxy-1,3-benzodioxol-4-yl)-2-(methylamino)ethanol (PubChem CID 117323117) has the molecular formula C11H15NO4 and a molecular weight of 225.24 g/mol. Its IUPAC name is 1-(6-methoxy-1,3-benzodioxol-4-yl)-2-(methylamino)ethanol.
| Compound Name | 1-(6-methoxy-1,3-benzodioxol-4-yl)-2-(methylamino)ethanol |
|---|---|
| PubChem CID | 117323117 |
| Molecular Formula | C11H15NO4 |
| Molecular Weight | 225.24 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | 1-(6-methoxy-1,3-benzodioxol-4-yl)-2-(methylamino)ethanol |
| SMILES | CNCC(O)c1cc(OC)cc2c1OCO2 |
| InChI | InChI=1S/C11H15NO4/c1-12-5-9(13)8-3-7(14-2)4-10-11(8)16-6-15-10/h3-4,9,12-13H,5-6H2,1-2H3 |
| InChIKey | XIAXKGOKMMITPJ-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.24 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |