C12H14O6 — CID 117388370
ethyl 2-hydroxy-2-(6-methoxy-1,3-benzodioxol-4-yl)acetate (PubChem CID 117388370) has the molecular formula C12H14O6 and a molecular weight of 254.24 g/mol. Its IUPAC name is ethyl 2-hydroxy-2-(6-methoxy-1,3-benzodioxol-4-yl)acetate.
| Compound Name | ethyl 2-hydroxy-2-(6-methoxy-1,3-benzodioxol-4-yl)acetate |
|---|---|
| PubChem CID | 117388370 |
| Molecular Formula | C12H14O6 |
| Molecular Weight | 254.24 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | ethyl 2-hydroxy-2-(6-methoxy-1,3-benzodioxol-4-yl)acetate |
| SMILES | CCOC(=O)C(O)c1cc(OC)cc2c1OCO2 |
| InChI | InChI=1S/C12H14O6/c1-3-16-12(14)10(13)8-4-7(15-2)5-9-11(8)18-6-17-9/h4-5,10,13H,3,6H2,1-2H3 |
| InChIKey | PATADCVCGLMSFD-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.24 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |